C11H9NO6 — CID 123957600
2-(1,3-benzodioxol-5-ylamino)-1,3-dioxane-4,6-dione (PubChem CID 123957600) has the molecular formula C11H9NO6 and a molecular weight of 251.19 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-1,3-dioxane-4,6-dione.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 123957600 |
| Molecular Formula | C11H9NO6 |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-1,3-dioxane-4,6-dione |
| SMILES | O=C1CC(=O)OC(Nc2ccc3c(c2)OCO3)O1 |
| InChI | InChI=1S/C11H9NO6/c13-9-4-10(14)18-11(17-9)12-6-1-2-7-8(3-6)16-5-15-7/h1-3,11-12H,4-5H2 |
| InChIKey | QVSPZIOJHCMNFY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|