C30H26N4O4 — CID 124553371
2-(2-oxobenzo[cd]indol-1-yl)-N-[(Z)-[4-[2-oxo-2-(2-phenylethylamino)ethoxy]phenyl]methylideneamino]acetamide (PubChem CID 124553371) has the molecular formula C30H26N4O4 and a molecular weight of 506.56 g/mol. Its IUPAC name is 2-(2-oxobenzo[cd]indol-1-yl)-N-[(Z)-[4-[2-oxo-2-(2-phenylethylamino)ethoxy]phenyl]methylideneamino]acetamide.
| Compound Name | 2-(2-oxobenzo[cd]indol-1-yl)-N-[(Z)-[4-[2-oxo-2-(2-phenylethylamino)ethoxy]phenyl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 124553371 |
| Molecular Formula | C30H26N4O4 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 2-(2-oxobenzo[cd]indol-1-yl)-N-[(Z)-[4-[2-oxo-2-(2-phenylethylamino)ethoxy]phenyl]methylideneamino]acetamide |
| SMILES | O=C(COc1ccc(/C=N\NC(=O)CN2C(=O)c3cccc4cccc2c34)cc1)NCCc1ccccc1 |
| InChI | InChI=1S/C30H26N4O4/c35-27(19-34-26-11-5-9-23-8-4-10-25(29(23)26)30(34)37)33-32-18-22-12-14-24(15-13-22)38-20-28(36)31-17-16-21-6-2-1-3-7-21/h1-15,18H,16-17,19-20H2,(H,31,36)(H,33,35)/b32-18- |
| InChIKey | VUHAMNHMVYCAPU-CAQPMQTCSA-N |
| XLogP | 3.69 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|