C22H24N2O3 — CID 124560426
benzyl (4R)-1-oxo-4-phenyl-2,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 124560426) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is benzyl (4R)-1-oxo-4-phenyl-2,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | benzyl (4R)-1-oxo-4-phenyl-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 124560426 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | benzyl (4R)-1-oxo-4-phenyl-2,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC2(CC1)C(=O)NC[C@@H]2c1ccccc1 |
| InChI | InChI=1S/C22H24N2O3/c25-20-22(19(15-23-20)18-9-5-2-6-10-18)11-13-24(14-12-22)21(26)27-16-17-7-3-1-4-8-17/h1-10,19H,11-16H2,(H,23,25)/t19-/m1/s1 |
| InChIKey | MWOCAZSNESQALU-LJQANCHMSA-N |
| XLogP | 3.32 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |