C20H22ClNO3S — CID 124564163
3-[(2R)-2-[4-[(2-chlorophenyl)methylsulfanyl]phenyl]morpholin-4-yl]propanoic acid (PubChem CID 124564163) has the molecular formula C20H22ClNO3S and a molecular weight of 391.92 g/mol. Its IUPAC name is 3-[(2R)-2-[4-[(2-chlorophenyl)methylsulfanyl]phenyl]morpholin-4-yl]propanoic acid.
| Compound Name | 3-[(2R)-2-[4-[(2-chlorophenyl)methylsulfanyl]phenyl]morpholin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 124564163 |
| Molecular Formula | C20H22ClNO3S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 3-[(2R)-2-[4-[(2-chlorophenyl)methylsulfanyl]phenyl]morpholin-4-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCO[C@H](c2ccc(SCc3ccccc3Cl)cc2)C1 |
| InChI | InChI=1S/C20H22ClNO3S/c21-18-4-2-1-3-16(18)14-26-17-7-5-15(6-8-17)19-13-22(11-12-25-19)10-9-20(23)24/h1-8,19H,9-14H2,(H,23,24)/t19-/m0/s1 |
| InChIKey | VXPAVQNPMAASIW-IBGZPJMESA-N |
| XLogP | 4.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |