C15H22O6 — CID 124565082
dimethyl (7S,9S)-7-prop-2-enyl-1,4-dioxaspiro[4.5]decane-7,9-dicarboxylate (PubChem CID 124565082) has the molecular formula C15H22O6 and a molecular weight of 298.33 g/mol. Its IUPAC name is dimethyl (7S,9S)-7-prop-2-enyl-1,4-dioxaspiro[4.5]decane-7,9-dicarboxylate.
| Compound Name | dimethyl (7S,9S)-7-prop-2-enyl-1,4-dioxaspiro[4.5]decane-7,9-dicarboxylate |
|---|---|
| PubChem CID | 124565082 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | dimethyl (7S,9S)-7-prop-2-enyl-1,4-dioxaspiro[4.5]decane-7,9-dicarboxylate |
| SMILES | C=CC[C@]1(C(=O)OC)C[C@H](C(=O)OC)CC2(C1)OCCO2 |
| InChI | InChI=1S/C15H22O6/c1-4-5-14(13(17)19-3)8-11(12(16)18-2)9-15(10-14)20-6-7-21-15/h4,11H,1,5-10H2,2-3H3/t11-,14-/m0/s1 |
| InChIKey | SLLXRPVUYYWQOQ-FZMZJTMJSA-N |
| XLogP | 1.44 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|