C6H11F2NO — CID 124565378
trans-(1R,6R)-6-amino-2,2-difluorocyclohexan-1-ol (PubChem CID 124565378) has the molecular formula C6H11F2NO and a molecular weight of 151.16 g/mol. Its IUPAC name is trans-(1R,6R)-6-amino-2,2-difluorocyclohexan-1-ol.
| Compound Name | trans-(1R,6R)-6-amino-2,2-difluorocyclohexan-1-ol |
|---|---|
| PubChem CID | 124565378 |
| Molecular Formula | C6H11F2NO |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | trans-(1R,6R)-6-amino-2,2-difluorocyclohexan-1-ol |
| SMILES | N[C@@H]1CCCC(F)(F)[C@@H]1O |
| InChI | InChI=1S/C6H11F2NO/c7-6(8)3-1-2-4(9)5(6)10/h4-5,10H,1-3,9H2/t4-,5-/m1/s1 |
| InChIKey | YELVGYMNGIHCKI-RFZPGFLSSA-N |
| XLogP | 0.49 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |