C6H10ClF2NO — CID 154938165
cis-(1S,6R)-6-(chloroamino)-2,2-difluorocyclohexan-1-ol (PubChem CID 154938165) has the molecular formula C6H10ClF2NO and a molecular weight of 185.60 g/mol. Its IUPAC name is cis-(1S,6R)-6-(chloroamino)-2,2-difluorocyclohexan-1-ol.
| Compound Name | cis-(1S,6R)-6-(chloroamino)-2,2-difluorocyclohexan-1-ol |
|---|---|
| PubChem CID | 154938165 |
| Molecular Formula | C6H10ClF2NO |
| Molecular Weight | 185.60 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | cis-(1S,6R)-6-(chloroamino)-2,2-difluorocyclohexan-1-ol |
| SMILES | O[C@H]1[C@H](NCl)CCCC1(F)F |
| InChI | InChI=1S/C6H10ClF2NO/c7-10-4-2-1-3-6(8,9)5(4)11/h4-5,10-11H,1-3H2/t4-,5+/m1/s1 |
| InChIKey | TWVRHTHGBKQXAL-UHNVWZDZSA-N |
| XLogP | 1.28 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.60 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|