C5H10Cl2N2 — CID 121422053
trans-(1R,2R)-1-N,2-N-dichlorocyclopentane-1,2-diamine (PubChem CID 121422053) has the molecular formula C5H10Cl2N2 and a molecular weight of 169.05 g/mol. Its IUPAC name is trans-(1R,2R)-1-N,2-N-dichlorocyclopentane-1,2-diamine.
| Compound Name | trans-(1R,2R)-1-N,2-N-dichlorocyclopentane-1,2-diamine |
|---|---|
| PubChem CID | 121422053 |
| Molecular Formula | C5H10Cl2N2 |
| Molecular Weight | 169.05 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | trans-(1R,2R)-1-N,2-N-dichlorocyclopentane-1,2-diamine |
| SMILES | ClN[C@@H]1CCC[C@H]1NCl |
| InChI | InChI=1S/C5H10Cl2N2/c6-8-4-2-1-3-5(4)9-7/h4-5,8-9H,1-3H2/t4-,5-/m1/s1 |
| InChIKey | ZKTUHGZLVHHLPJ-RFZPGFLSSA-N |
| XLogP | 1.39 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.05 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|