C13H16N4O5S — CID 124568605
1-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]-3-[(4S)-4,5,6,7-tetrahydro-1-benzofuran-4-yl]urea (PubChem CID 124568605) has the molecular formula C13H16N4O5S and a molecular weight of 340.36 g/mol. Its IUPAC name is 1-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]-3-[(4S)-4,5,6,7-tetrahydro-1-benzofuran-4-yl]urea.
| Compound Name | 1-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]-3-[(4S)-4,5,6,7-tetrahydro-1-benzofuran-4-yl]urea |
|---|---|
| PubChem CID | 124568605 |
| Molecular Formula | C13H16N4O5S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 1-[3-(methylsulfonylmethyl)-1,2,4-oxadiazol-5-yl]-3-[(4S)-4,5,6,7-tetrahydro-1-benzofuran-4-yl]urea |
| SMILES | CS(=O)(=O)Cc1noc(NC(=O)N[C@H]2CCCc3occc32)n1 |
| InChI | InChI=1S/C13H16N4O5S/c1-23(19,20)7-11-15-13(22-17-11)16-12(18)14-9-3-2-4-10-8(9)5-6-21-10/h5-6,9H,2-4,7H2,1H3,(H2,14,15,16,17,18)/t9-/m0/s1 |
| InChIKey | DULGKUDKDPRLDT-VIFPVBQESA-N |
| XLogP | 1.41 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |