C16H19N3O4S — CID 124576290
(4S)-N-(5-ethylsulfonyl-2-hydroxyphenyl)-4,5,6,7-tetrahydro-1H-indazole-4-carboxamide (PubChem CID 124576290) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is (4S)-N-(5-ethylsulfonyl-2-hydroxyphenyl)-4,5,6,7-tetrahydro-1H-indazole-4-carboxamide.
| Compound Name | (4S)-N-(5-ethylsulfonyl-2-hydroxyphenyl)-4,5,6,7-tetrahydro-1H-indazole-4-carboxamide |
|---|---|
| PubChem CID | 124576290 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | (4S)-N-(5-ethylsulfonyl-2-hydroxyphenyl)-4,5,6,7-tetrahydro-1H-indazole-4-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(O)c(NC(=O)[C@H]2CCCc3[nH]ncc32)c1 |
| InChI | InChI=1S/C16H19N3O4S/c1-2-24(22,23)10-6-7-15(20)14(8-10)18-16(21)11-4-3-5-13-12(11)9-17-19-13/h6-9,11,20H,2-5H2,1H3,(H,17,19)(H,18,21)/t11-/m0/s1 |
| InChIKey | DXJKYHGYIBBSTB-NSHDSACASA-N |
| XLogP | 1.97 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|