C14H14FN3O2 — CID 99782658
(4R)-N-(2-fluoro-4-hydroxyphenyl)-4,5,6,7-tetrahydro-1H-indazole-4-carboxamide (PubChem CID 99782658) has the molecular formula C14H14FN3O2 and a molecular weight of 275.28 g/mol. Its IUPAC name is (4R)-N-(2-fluoro-4-hydroxyphenyl)-4,5,6,7-tetrahydro-1H-indazole-4-carboxamide.
| Compound Name | (4R)-N-(2-fluoro-4-hydroxyphenyl)-4,5,6,7-tetrahydro-1H-indazole-4-carboxamide |
|---|---|
| PubChem CID | 99782658 |
| Molecular Formula | C14H14FN3O2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | (4R)-N-(2-fluoro-4-hydroxyphenyl)-4,5,6,7-tetrahydro-1H-indazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(O)cc1F)[C@@H]1CCCc2[nH]ncc21 |
| InChI | InChI=1S/C14H14FN3O2/c15-11-6-8(19)4-5-13(11)17-14(20)9-2-1-3-12-10(9)7-16-18-12/h4-7,9,19H,1-3H2,(H,16,18)(H,17,20)/t9-/m1/s1 |
| InChIKey | QQFDOZKJBYRULX-SECBINFHSA-N |
| XLogP | 2.31 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|