C13H14F2N2O3 — CID 166385310
4-[(2-fluoro-4-hydroxyphenyl)carbamoyl]piperidine-1-carbonyl fluoride (PubChem CID 166385310) has the molecular formula C13H14F2N2O3 and a molecular weight of 284.26 g/mol. Its IUPAC name is 4-[(2-fluoro-4-hydroxyphenyl)carbamoyl]piperidine-1-carbonyl fluoride.
| Compound Name | 4-[(2-fluoro-4-hydroxyphenyl)carbamoyl]piperidine-1-carbonyl fluoride |
|---|---|
| PubChem CID | 166385310 |
| Molecular Formula | C13H14F2N2O3 |
| Molecular Weight | 284.26 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 4-[(2-fluoro-4-hydroxyphenyl)carbamoyl]piperidine-1-carbonyl fluoride |
| SMILES | O=C(Nc1ccc(O)cc1F)C1CCN(C(=O)F)CC1 |
| InChI | InChI=1S/C13H14F2N2O3/c14-10-7-9(18)1-2-11(10)16-12(19)8-3-5-17(6-4-8)13(15)20/h1-2,7-8,18H,3-6H2,(H,16,19) |
| InChIKey | RMMCPGCHNHUUOB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|