C16H21ClN2O3 — CID 124589488
N-[(2R)-4-(4-chloro-2-hydroxyanilino)-4-oxobutan-2-yl]cyclopentanecarboxamide (PubChem CID 124589488) has the molecular formula C16H21ClN2O3 and a molecular weight of 324.81 g/mol. Its IUPAC name is N-[(2R)-4-(4-chloro-2-hydroxyanilino)-4-oxobutan-2-yl]cyclopentanecarboxamide.
| Compound Name | N-[(2R)-4-(4-chloro-2-hydroxyanilino)-4-oxobutan-2-yl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 124589488 |
| Molecular Formula | C16H21ClN2O3 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-[(2R)-4-(4-chloro-2-hydroxyanilino)-4-oxobutan-2-yl]cyclopentanecarboxamide |
| SMILES | C[C@H](CC(=O)Nc1ccc(Cl)cc1O)NC(=O)C1CCCC1 |
| InChI | InChI=1S/C16H21ClN2O3/c1-10(18-16(22)11-4-2-3-5-11)8-15(21)19-13-7-6-12(17)9-14(13)20/h6-7,9-11,20H,2-5,8H2,1H3,(H,18,22)(H,19,21)/t10-/m1/s1 |
| InChIKey | YRZKACSDIUMGHX-SNVBAGLBSA-N |
| XLogP | 3.07 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|