C31H29FIN3O8 — CID 124601072
2-[4-[(E)-[1-(2,5-diethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]-N-(4-fluorophenyl)acetamide (PubChem CID 124601072) has the molecular formula C31H29FIN3O8 and a molecular weight of 717.49 g/mol. Its IUPAC name is 2-[4-[(E)-[1-(2,5-diethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-[(E)-[1-(2,5-diethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 124601072 |
| Molecular Formula | C31H29FIN3O8 |
| Molecular Weight | 717.49 g/mol |
| Exact Mass | 717.10 |
| IUPAC Name | 2-[4-[(E)-[1-(2,5-diethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]-N-(4-fluorophenyl)acetamide |
| SMILES | CCOc1ccc(OCC)c(N2C(=O)NC(=O)/C(=C\c3cc(I)c(OCC(=O)Nc4ccc(F)cc4)c(OCC)c3)C2=O)c1 |
| InChI | InChI=1S/C31H29FIN3O8/c1-4-41-21-11-12-25(42-5-2)24(16-21)36-30(39)22(29(38)35-31(36)40)13-18-14-23(33)28(26(15-18)43-6-3)44-17-27(37)34-20-9-7-19(32)8-10-20/h7-16H,4-6,17H2,1-3H3,(H,34,37)(H,35,38,40)/b22-13+ |
| InChIKey | LIISOHYTAJDZNO-LPYMAVHISA-N |
| XLogP | 5.31 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.49 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|