C25H24Br2N2O8 — CID 124601034
ethyl 2-[2,6-dibromo-4-[(E)-[1-(2,5-diethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetate (PubChem CID 124601034) has the molecular formula C25H24Br2N2O8 and a molecular weight of 640.28 g/mol. Its IUPAC name is ethyl 2-[2,6-dibromo-4-[(E)-[1-(2,5-diethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2,6-dibromo-4-[(E)-[1-(2,5-diethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 124601034 |
| Molecular Formula | C25H24Br2N2O8 |
| Molecular Weight | 640.28 g/mol |
| Exact Mass | 637.99 |
| IUPAC Name | ethyl 2-[2,6-dibromo-4-[(E)-[1-(2,5-diethoxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(/C=C2\C(=O)NC(=O)N(c3cc(OCC)ccc3OCC)C2=O)cc1Br |
| InChI | InChI=1S/C25H24Br2N2O8/c1-4-34-15-7-8-20(35-5-2)19(12-15)29-24(32)16(23(31)28-25(29)33)9-14-10-17(26)22(18(27)11-14)37-13-21(30)36-6-3/h7-12H,4-6,13H2,1-3H3,(H,28,31,33)/b16-9+ |
| InChIKey | CHWTXXWOCVLUPV-CXUHLZMHSA-N |
| XLogP | 4.62 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.28 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|