C17H26N4 — CID 124606532
3-[(2S)-1-[(1R)-cyclohex-2-en-1-yl]piperidin-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 124606532) has the molecular formula C17H26N4 and a molecular weight of 286.42 g/mol. Its IUPAC name is 3-[(2S)-1-[(1R)-cyclohex-2-en-1-yl]piperidin-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-[(2S)-1-[(1R)-cyclohex-2-en-1-yl]piperidin-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 124606532 |
| Molecular Formula | C17H26N4 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | 3-[(2S)-1-[(1R)-cyclohex-2-en-1-yl]piperidin-2-yl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | C1=C[C@H](N2CCCC[C@H]2c2nnc3n2CCCC3)CCC1 |
| InChI | InChI=1S/C17H26N4/c1-2-8-14(9-3-1)20-12-6-4-10-15(20)17-19-18-16-11-5-7-13-21(16)17/h2,8,14-15H,1,3-7,9-13H2/t14-,15-/m0/s1 |
| InChIKey | NMIYMHUISNUAON-GJZGRUSLSA-N |
| XLogP | 3.25 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|