C19H21FN2O3 — CID 124609800
(2S)-N-[4-(3-fluorophenyl)-3-pyridinyl]-2-[[(2S)-oxolan-2-yl]methoxy]propanamide (PubChem CID 124609800) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is (2S)-N-[4-(3-fluorophenyl)-3-pyridinyl]-2-[[(2S)-oxolan-2-yl]methoxy]propanamide.
| Compound Name | (2S)-N-[4-(3-fluorophenyl)-3-pyridinyl]-2-[[(2S)-oxolan-2-yl]methoxy]propanamide |
|---|---|
| PubChem CID | 124609800 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (2S)-N-[4-(3-fluorophenyl)-3-pyridinyl]-2-[[(2S)-oxolan-2-yl]methoxy]propanamide |
| SMILES | C[C@H](OC[C@@H]1CCCO1)C(=O)Nc1cnccc1-c1cccc(F)c1 |
| InChI | InChI=1S/C19H21FN2O3/c1-13(25-12-16-6-3-9-24-16)19(23)22-18-11-21-8-7-17(18)14-4-2-5-15(20)10-14/h2,4-5,7-8,10-11,13,16H,3,6,9,12H2,1H3,(H,22,23)/t13-,16-/m0/s1 |
| InChIKey | VCYOMVOMAOMPBP-BBRMVZONSA-N |
| XLogP | 3.41 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |