C18H22FN3O3 — CID 124617036
(2S)-N-[2-(3-fluorophenyl)pyrazol-3-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide (PubChem CID 124617036) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is (2S)-N-[2-(3-fluorophenyl)pyrazol-3-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide.
| Compound Name | (2S)-N-[2-(3-fluorophenyl)pyrazol-3-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide |
|---|---|
| PubChem CID | 124617036 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (2S)-N-[2-(3-fluorophenyl)pyrazol-3-yl]-2-[[(2R)-oxan-2-yl]methoxy]propanamide |
| SMILES | C[C@H](OC[C@H]1CCCCO1)C(=O)Nc1ccnn1-c1cccc(F)c1 |
| InChI | InChI=1S/C18H22FN3O3/c1-13(25-12-16-7-2-3-10-24-16)18(23)21-17-8-9-20-22(17)15-6-4-5-14(19)11-15/h4-6,8-9,11,13,16H,2-3,7,10,12H2,1H3,(H,21,23)/t13-,16+/m0/s1 |
| InChIKey | XSURSTDKAPMQPX-XJKSGUPXSA-N |
| XLogP | 2.92 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |