C16H20ClN3O3 — CID 124615405
2-[[(2R,3R)-2-(4-chlorophenyl)oxolan-3-yl]carbamoylamino]-N-prop-2-enylacetamide (PubChem CID 124615405) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is 2-[[(2R,3R)-2-(4-chlorophenyl)oxolan-3-yl]carbamoylamino]-N-prop-2-enylacetamide.
| Compound Name | 2-[[(2R,3R)-2-(4-chlorophenyl)oxolan-3-yl]carbamoylamino]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 124615405 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 2-[[(2R,3R)-2-(4-chlorophenyl)oxolan-3-yl]carbamoylamino]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CNC(=O)N[C@@H]1CCO[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H20ClN3O3/c1-2-8-18-14(21)10-19-16(22)20-13-7-9-23-15(13)11-3-5-12(17)6-4-11/h2-6,13,15H,1,7-10H2,(H,18,21)(H2,19,20,22)/t13-,15-/m1/s1 |
| InChIKey | PPSLVJAIPORVBV-UKRRQHHQSA-N |
| XLogP | 1.77 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|