C20H20N2O3 — CID 124616807
2-(2-oxo-1,3-dihydroindol-6-yl)-N-[(2R)-4-oxo-4-phenylbutan-2-yl]acetamide (PubChem CID 124616807) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-(2-oxo-1,3-dihydroindol-6-yl)-N-[(2R)-4-oxo-4-phenylbutan-2-yl]acetamide.
| Compound Name | 2-(2-oxo-1,3-dihydroindol-6-yl)-N-[(2R)-4-oxo-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 124616807 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-(2-oxo-1,3-dihydroindol-6-yl)-N-[(2R)-4-oxo-4-phenylbutan-2-yl]acetamide |
| SMILES | C[C@H](CC(=O)c1ccccc1)NC(=O)Cc1ccc2c(c1)NC(=O)C2 |
| InChI | InChI=1S/C20H20N2O3/c1-13(9-18(23)15-5-3-2-4-6-15)21-19(24)11-14-7-8-16-12-20(25)22-17(16)10-14/h2-8,10,13H,9,11-12H2,1H3,(H,21,24)(H,22,25)/t13-/m1/s1 |
| InChIKey | LUFVBXJKZHPLDZ-CYBMUJFWSA-N |
| XLogP | 2.50 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |