C17H23FN4O — CID 124618010
N-tert-butyl-2-[[(R)-(4-fluorophenyl)-(1-methylpyrazol-4-yl)methyl]amino]acetamide (PubChem CID 124618010) has the molecular formula C17H23FN4O and a molecular weight of 318.40 g/mol. Its IUPAC name is N-tert-butyl-2-[[(R)-(4-fluorophenyl)-(1-methylpyrazol-4-yl)methyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[(R)-(4-fluorophenyl)-(1-methylpyrazol-4-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 124618010 |
| Molecular Formula | C17H23FN4O |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-tert-butyl-2-[[(R)-(4-fluorophenyl)-(1-methylpyrazol-4-yl)methyl]amino]acetamide |
| SMILES | Cn1cc([C@H](NCC(=O)NC(C)(C)C)c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C17H23FN4O/c1-17(2,3)21-15(23)10-19-16(13-9-20-22(4)11-13)12-5-7-14(18)8-6-12/h5-9,11,16,19H,10H2,1-4H3,(H,21,23)/t16-/m1/s1 |
| InChIKey | WTDOOQPGUXKWNL-MRXNPFEDSA-N |
| XLogP | 2.15 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |