C20H20FN3O — CID 124619528
(1R)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-(4-fluorophenyl)-1-(1-methylpyrazol-4-yl)methanamine (PubChem CID 124619528) has the molecular formula C20H20FN3O and a molecular weight of 337.40 g/mol. Its IUPAC name is (1R)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-(4-fluorophenyl)-1-(1-methylpyrazol-4-yl)methanamine.
| Compound Name | (1R)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-(4-fluorophenyl)-1-(1-methylpyrazol-4-yl)methanamine |
|---|---|
| PubChem CID | 124619528 |
| Molecular Formula | C20H20FN3O |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | (1R)-N-(2,3-dihydro-1-benzofuran-5-ylmethyl)-1-(4-fluorophenyl)-1-(1-methylpyrazol-4-yl)methanamine |
| SMILES | Cn1cc([C@H](NCc2ccc3c(c2)CCO3)c2ccc(F)cc2)cn1 |
| InChI | InChI=1S/C20H20FN3O/c1-24-13-17(12-23-24)20(15-3-5-18(21)6-4-15)22-11-14-2-7-19-16(10-14)8-9-25-19/h2-7,10,12-13,20,22H,8-9,11H2,1H3/t20-/m1/s1 |
| InChIKey | NRZQNGGRNRKQAB-HXUWFJFHSA-N |
| XLogP | 3.37 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|