C20H20N4O2 — CID 124624596
4-[(3R)-3-[2-cyanoethyl(furan-2-ylmethyl)amino]-2-oxopiperidin-1-yl]benzonitrile (PubChem CID 124624596) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is 4-[(3R)-3-[2-cyanoethyl(furan-2-ylmethyl)amino]-2-oxopiperidin-1-yl]benzonitrile.
| Compound Name | 4-[(3R)-3-[2-cyanoethyl(furan-2-ylmethyl)amino]-2-oxopiperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 124624596 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 4-[(3R)-3-[2-cyanoethyl(furan-2-ylmethyl)amino]-2-oxopiperidin-1-yl]benzonitrile |
| SMILES | N#CCCN(Cc1ccco1)[C@@H]1CCCN(c2ccc(C#N)cc2)C1=O |
| InChI | InChI=1S/C20H20N4O2/c21-10-3-11-23(15-18-4-2-13-26-18)19-5-1-12-24(20(19)25)17-8-6-16(14-22)7-9-17/h2,4,6-9,13,19H,1,3,5,11-12,15H2/t19-/m1/s1 |
| InChIKey | JSVLAVIRWQUGTC-LJQANCHMSA-N |
| XLogP | 3.06 |
| TPSA | 84.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |