C14H18BrN3O2 — CID 124627053
1-(3-bromo-5-methylphenyl)-3-[(3S,4S)-4-methyl-2-oxopiperidin-3-yl]urea (PubChem CID 124627053) has the molecular formula C14H18BrN3O2 and a molecular weight of 340.22 g/mol. Its IUPAC name is 1-(3-bromo-5-methylphenyl)-3-[(3S,4S)-4-methyl-2-oxopiperidin-3-yl]urea.
| Compound Name | 1-(3-bromo-5-methylphenyl)-3-[(3S,4S)-4-methyl-2-oxopiperidin-3-yl]urea |
|---|---|
| PubChem CID | 124627053 |
| Molecular Formula | C14H18BrN3O2 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 1-(3-bromo-5-methylphenyl)-3-[(3S,4S)-4-methyl-2-oxopiperidin-3-yl]urea |
| SMILES | Cc1cc(Br)cc(NC(=O)N[C@@H]2C(=O)NCC[C@@H]2C)c1 |
| InChI | InChI=1S/C14H18BrN3O2/c1-8-5-10(15)7-11(6-8)17-14(20)18-12-9(2)3-4-16-13(12)19/h5-7,9,12H,3-4H2,1-2H3,(H,16,19)(H2,17,18,20)/t9-,12-/m0/s1 |
| InChIKey | XAKKRYMKXNPQKG-CABZTGNLSA-N |
| XLogP | 2.40 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |