C19H25N3O3 — CID 59100738
1-(3,5-dimethylphenyl)-3-[(E,2S)-5-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]hex-3-en-2-yl]urea (PubChem CID 59100738) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[(E,2S)-5-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]hex-3-en-2-yl]urea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[(E,2S)-5-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]hex-3-en-2-yl]urea |
|---|---|
| PubChem CID | 59100738 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[(E,2S)-5-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]hex-3-en-2-yl]urea |
| SMILES | CC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C19H25N3O3/c1-12-8-13(2)10-17(9-12)22-19(25)21-16(5-4-14(3)23)11-15-6-7-20-18(15)24/h4-5,8-10,15-16H,6-7,11H2,1-3H3,(H,20,24)(H2,21,22,25)/b5-4+/t15-,16+/m0/s1 |
| InChIKey | QCJWAPDYLQKCIF-CGFBPQRUSA-N |
| XLogP | 2.46 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|