C17H20F2N2O3 — CID 124627095
[(2R)-1-benzoylpyrrolidin-2-yl]-[(2R)-2-(difluoromethyl)morpholin-4-yl]methanone (PubChem CID 124627095) has the molecular formula C17H20F2N2O3 and a molecular weight of 338.35 g/mol. Its IUPAC name is [(2R)-1-benzoylpyrrolidin-2-yl]-[(2R)-2-(difluoromethyl)morpholin-4-yl]methanone.
| Compound Name | [(2R)-1-benzoylpyrrolidin-2-yl]-[(2R)-2-(difluoromethyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 124627095 |
| Molecular Formula | C17H20F2N2O3 |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | [(2R)-1-benzoylpyrrolidin-2-yl]-[(2R)-2-(difluoromethyl)morpholin-4-yl]methanone |
| SMILES | O=C([C@H]1CCCN1C(=O)c1ccccc1)N1CCO[C@@H](C(F)F)C1 |
| InChI | InChI=1S/C17H20F2N2O3/c18-15(19)14-11-20(9-10-24-14)17(23)13-7-4-8-21(13)16(22)12-5-2-1-3-6-12/h1-3,5-6,13-15H,4,7-11H2/t13-,14-/m1/s1 |
| InChIKey | XGVNUKMMZCPWHE-ZIAGYGMSSA-N |
| XLogP | 1.78 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |