C15H24N2O3S — CID 124628636
(3S)-1-[(2S)-2-methoxypropyl]sulfonyl-N-phenylpiperidin-3-amine (PubChem CID 124628636) has the molecular formula C15H24N2O3S and a molecular weight of 312.43 g/mol. Its IUPAC name is (3S)-1-[(2S)-2-methoxypropyl]sulfonyl-N-phenylpiperidin-3-amine.
| Compound Name | (3S)-1-[(2S)-2-methoxypropyl]sulfonyl-N-phenylpiperidin-3-amine |
|---|---|
| PubChem CID | 124628636 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (3S)-1-[(2S)-2-methoxypropyl]sulfonyl-N-phenylpiperidin-3-amine |
| SMILES | CO[C@@H](C)CS(=O)(=O)N1CCC[C@H](Nc2ccccc2)C1 |
| InChI | InChI=1S/C15H24N2O3S/c1-13(20-2)12-21(18,19)17-10-6-9-15(11-17)16-14-7-4-3-5-8-14/h3-5,7-8,13,15-16H,6,9-12H2,1-2H3/t13-,15-/m0/s1 |
| InChIKey | WHMVFWXYKWVFPI-ZFWWWQNUSA-N |
| XLogP | 1.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |