C16H22F3N3O — CID 97238788
(2R)-2-[(3S)-3-anilinopiperidin-1-yl]-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 97238788) has the molecular formula C16H22F3N3O and a molecular weight of 329.37 g/mol. Its IUPAC name is (2R)-2-[(3S)-3-anilinopiperidin-1-yl]-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | (2R)-2-[(3S)-3-anilinopiperidin-1-yl]-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 97238788 |
| Molecular Formula | C16H22F3N3O |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (2R)-2-[(3S)-3-anilinopiperidin-1-yl]-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | C[C@H](C(=O)NCC(F)(F)F)N1CCC[C@H](Nc2ccccc2)C1 |
| InChI | InChI=1S/C16H22F3N3O/c1-12(15(23)20-11-16(17,18)19)22-9-5-8-14(10-22)21-13-6-3-2-4-7-13/h2-4,6-7,12,14,21H,5,8-11H2,1H3,(H,20,23)/t12-,14+/m1/s1 |
| InChIKey | ZJOYAYOGCSDAKW-OCCSQVGLSA-N |
| XLogP | 2.63 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |