C28H22N2O2S2 — CID 124631014
(11R,14E)-14-[(4-prop-2-enoxyphenyl)methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 124631014) has the molecular formula C28H22N2O2S2 and a molecular weight of 482.63 g/mol. Its IUPAC name is (11R,14E)-14-[(4-prop-2-enoxyphenyl)methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11R,14E)-14-[(4-prop-2-enoxyphenyl)methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 124631014 |
| Molecular Formula | C28H22N2O2S2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | (11R,14E)-14-[(4-prop-2-enoxyphenyl)methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | C=CCOc1ccc(/C=c2/sc3n(c2=O)[C@@H](c2cccs2)C2=C(N=3)c3ccccc3CC2)cc1 |
| InChI | InChI=1S/C28H22N2O2S2/c1-2-15-32-20-12-9-18(10-13-20)17-24-27(31)30-26(23-8-5-16-33-23)22-14-11-19-6-3-4-7-21(19)25(22)29-28(30)34-24/h2-10,12-13,16-17,26H,1,11,14-15H2/b24-17+/t26-/m1/s1 |
| InChIKey | APBZZMZQNKVNQN-OGRZUZBBSA-N |
| XLogP | 4.95 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|