C27H22N2O3S2 — CID 129443974
(11S)-14-[(2,4-dimethoxyphenyl)methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 129443974) has the molecular formula C27H22N2O3S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is (11S)-14-[(2,4-dimethoxyphenyl)methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11S)-14-[(2,4-dimethoxyphenyl)methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 129443974 |
| Molecular Formula | C27H22N2O3S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | (11S)-14-[(2,4-dimethoxyphenyl)methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | COc1ccc(C=c2sc3n(c2=O)[C@H](c2cccs2)C2=C(N=3)c3ccccc3CC2)c(OC)c1 |
| InChI | InChI=1S/C27H22N2O3S2/c1-31-18-11-9-17(21(15-18)32-2)14-23-26(30)29-25(22-8-5-13-33-22)20-12-10-16-6-3-4-7-19(16)24(20)28-27(29)34-23/h3-9,11,13-15,25H,10,12H2,1-2H3/t25-/m0/s1 |
| InChIKey | QPNSTJPGMNGASZ-VWLOTQADSA-N |
| XLogP | 4.40 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |