C27H22N2O2S2 — CID 23774657
14-[(4-ethoxyphenyl)methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 23774657) has the molecular formula C27H22N2O2S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 14-[(4-ethoxyphenyl)methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | 14-[(4-ethoxyphenyl)methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 23774657 |
| Molecular Formula | C27H22N2O2S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | 14-[(4-ethoxyphenyl)methylidene]-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | CCOc1ccc(C=c2sc3n(c2=O)C(c2cccs2)C2=C(N=3)c3ccccc3CC2)cc1 |
| InChI | InChI=1S/C27H22N2O2S2/c1-2-31-19-12-9-17(10-13-19)16-23-26(30)29-25(22-8-5-15-32-22)21-14-11-18-6-3-4-7-20(18)24(21)28-27(29)33-23/h3-10,12-13,15-16,25H,2,11,14H2,1H3 |
| InChIKey | KUGGSZLLNVRUJY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |