C33H22N2OS2 — CID 98155780
(11S,14E)-14-(anthracen-9-ylmethylidene)-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one (PubChem CID 98155780) has the molecular formula C33H22N2OS2 and a molecular weight of 526.69 g/mol. Its IUPAC name is (11S,14E)-14-(anthracen-9-ylmethylidene)-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one.
| Compound Name | (11S,14E)-14-(anthracen-9-ylmethylidene)-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
|---|---|
| PubChem CID | 98155780 |
| Molecular Formula | C33H22N2OS2 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | (11S,14E)-14-(anthracen-9-ylmethylidene)-11-thiophen-2-yl-15-thia-12,17-diazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,16-pentaen-13-one |
| SMILES | O=c1/c(=C\c2c3ccccc3cc3ccccc23)sc2n1[C@H](c1cccs1)C1=C(N=2)c2ccccc2CC1 |
| InChI | InChI=1S/C33H22N2OS2/c36-32-29(19-27-23-11-4-2-9-21(23)18-22-10-3-5-12-24(22)27)38-33-34-30-25-13-6-1-8-20(25)15-16-26(30)31(35(32)33)28-14-7-17-37-28/h1-14,17-19,31H,15-16H2/b29-19+/t31-/m0/s1 |
| InChIKey | NONKTBHTOJXYGB-OGMUYLFESA-N |
| XLogP | 6.69 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|