C11H23NO3Si — CID 124635577
tert-butyl (5S)-5-(hydroxymethyl)-3,3-dimethyl-1,3-azasilolidine-1-carboxylate (PubChem CID 124635577) has the molecular formula C11H23NO3Si and a molecular weight of 245.39 g/mol. Its IUPAC name is tert-butyl (5S)-5-(hydroxymethyl)-3,3-dimethyl-1,3-azasilolidine-1-carboxylate.
| Compound Name | tert-butyl (5S)-5-(hydroxymethyl)-3,3-dimethyl-1,3-azasilolidine-1-carboxylate |
|---|---|
| PubChem CID | 124635577 |
| Molecular Formula | C11H23NO3Si |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | tert-butyl (5S)-5-(hydroxymethyl)-3,3-dimethyl-1,3-azasilolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[Si](C)(C)C[C@@H]1CO |
| InChI | InChI=1S/C11H23NO3Si/c1-11(2,3)15-10(14)12-8-16(4,5)7-9(12)6-13/h9,13H,6-8H2,1-5H3/t9-/m0/s1 |
| InChIKey | QPSQTMVGFMODPI-VIFPVBQESA-N |
| XLogP | 1.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|