C12H23NO4Si — CID 85248502
1-O-tert-butyl 5-O-methyl 3,3-dimethyl-1,3-azasilolidine-1,5-dicarboxylate (PubChem CID 85248502) has the molecular formula C12H23NO4Si and a molecular weight of 273.40 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-methyl 3,3-dimethyl-1,3-azasilolidine-1,5-dicarboxylate.
| Compound Name | 1-O-tert-butyl 5-O-methyl 3,3-dimethyl-1,3-azasilolidine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 85248502 |
| Molecular Formula | C12H23NO4Si |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 1-O-tert-butyl 5-O-methyl 3,3-dimethyl-1,3-azasilolidine-1,5-dicarboxylate |
| SMILES | COC(=O)C1C[Si](C)(C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23NO4Si/c1-12(2,3)17-11(15)13-8-18(5,6)7-9(13)10(14)16-4/h9H,7-8H2,1-6H3 |
| InChIKey | WAAZRCXPHATHEC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|