C20H19NO — CID 124636697
(3R)-3-[4-[(2-methylphenyl)methoxy]phenyl]hex-4-ynenitrile (PubChem CID 124636697) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is (3R)-3-[4-[(2-methylphenyl)methoxy]phenyl]hex-4-ynenitrile.
| Compound Name | (3R)-3-[4-[(2-methylphenyl)methoxy]phenyl]hex-4-ynenitrile |
|---|---|
| PubChem CID | 124636697 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (3R)-3-[4-[(2-methylphenyl)methoxy]phenyl]hex-4-ynenitrile |
| SMILES | CC#C[C@H](CC#N)c1ccc(OCc2ccccc2C)cc1 |
| InChI | InChI=1S/C20H19NO/c1-3-6-17(13-14-21)18-9-11-20(12-10-18)22-15-19-8-5-4-7-16(19)2/h4-5,7-12,17H,13,15H2,1-2H3/t17-/m1/s1 |
| InChIKey | QPULLHNNTBZNCP-QGZVFWFLSA-N |
| XLogP | 4.59 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|