C30H29NO3 — CID 144624256
3-[4-[[7-methyl-1-[(2-methylphenyl)methyl]indol-6-yl]methoxy]phenyl]hex-4-ynoic acid (PubChem CID 144624256) has the molecular formula C30H29NO3 and a molecular weight of 451.57 g/mol. Its IUPAC name is 3-[4-[[7-methyl-1-[(2-methylphenyl)methyl]indol-6-yl]methoxy]phenyl]hex-4-ynoic acid.
| Compound Name | 3-[4-[[7-methyl-1-[(2-methylphenyl)methyl]indol-6-yl]methoxy]phenyl]hex-4-ynoic acid |
|---|---|
| PubChem CID | 144624256 |
| Molecular Formula | C30H29NO3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 3-[4-[[7-methyl-1-[(2-methylphenyl)methyl]indol-6-yl]methoxy]phenyl]hex-4-ynoic acid |
| SMILES | CC#CC(CC(=O)O)c1ccc(OCc2ccc3ccn(Cc4ccccc4C)c3c2C)cc1 |
| InChI | InChI=1S/C30H29NO3/c1-4-7-25(18-29(32)33)23-12-14-28(15-13-23)34-20-27-11-10-24-16-17-31(30(24)22(27)3)19-26-9-6-5-8-21(26)2/h5-6,8-17,25H,18-20H2,1-3H3,(H,32,33) |
| InChIKey | CIRFHDXLDRKRPX-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|