C13H16N4O3 — CID 124639865
(4R,5S)-5-amino-4-nitroso-2-(2-propoxyphenyl)-5H-pyrimidin-4-ol (PubChem CID 124639865) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is (4R,5S)-5-amino-4-nitroso-2-(2-propoxyphenyl)-5H-pyrimidin-4-ol.
| Compound Name | (4R,5S)-5-amino-4-nitroso-2-(2-propoxyphenyl)-5H-pyrimidin-4-ol |
|---|---|
| PubChem CID | 124639865 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (4R,5S)-5-amino-4-nitroso-2-(2-propoxyphenyl)-5H-pyrimidin-4-ol |
| SMILES | CCCOc1ccccc1C1=N[C@@](O)(N=O)[C@@H](N)C=N1 |
| InChI | InChI=1S/C13H16N4O3/c1-2-7-20-10-6-4-3-5-9(10)12-15-8-11(14)13(18,16-12)17-19/h3-6,8,11,18H,2,7,14H2,1H3/t11-,13+/m0/s1 |
| InChIKey | ODZBGFITIIBYAG-WCQYABFASA-N |
| XLogP | 1.05 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |