C9H17NO2 — CID 124654196
methyl (2R)-2,4,4-trimethylpyrrolidine-2-carboxylate (PubChem CID 124654196) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is methyl (2R)-2,4,4-trimethylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2R)-2,4,4-trimethylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 124654196 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | methyl (2R)-2,4,4-trimethylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@]1(C)CC(C)(C)CN1 |
| InChI | InChI=1S/C9H17NO2/c1-8(2)5-9(3,10-6-8)7(11)12-4/h10H,5-6H2,1-4H3/t9-/m1/s1 |
| InChIKey | GJHVKVACKVNPKT-SECBINFHSA-N |
| XLogP | 0.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |