C9H13NO2 — CID 124660836
[(1R,2S)-2-cyanocyclopentyl] propanoate (PubChem CID 124660836) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is [(1R,2S)-2-cyanocyclopentyl] propanoate.
| Compound Name | [(1R,2S)-2-cyanocyclopentyl] propanoate |
|---|---|
| PubChem CID | 124660836 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | [(1R,2S)-2-cyanocyclopentyl] propanoate |
| SMILES | CCC(=O)O[C@@H]1CCC[C@H]1C#N |
| InChI | InChI=1S/C9H13NO2/c1-2-9(11)12-8-5-3-4-7(8)6-10/h7-8H,2-5H2,1H3/t7-,8+/m0/s1 |
| InChIKey | OQFIEFZZPYTTCS-JGVFFNPUSA-N |
| XLogP | 1.63 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |