C12H17NOS — CID 124678443
(1R,3R,5R)-3-benzyl-5-methyl-1,4-thiazinane 1-oxide (PubChem CID 124678443) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is (1R,3R,5R)-3-benzyl-5-methyl-1,4-thiazinane 1-oxide.
| Compound Name | (1R,3R,5R)-3-benzyl-5-methyl-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 124678443 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (1R,3R,5R)-3-benzyl-5-methyl-1,4-thiazinane 1-oxide |
| SMILES | C[C@@H]1C[S@@](=O)C[C@@H](Cc2ccccc2)N1 |
| InChI | InChI=1S/C12H17NOS/c1-10-8-15(14)9-12(13-10)7-11-5-3-2-4-6-11/h2-6,10,12-13H,7-9H2,1H3/t10-,12-,15-/m1/s1 |
| InChIKey | JKNNUKNXKBMBTA-IXPVHAAZSA-N |
| XLogP | 1.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |