C7H12BrNO — CID 124705409
(5R)-5-(bromomethyl)-3,3-dimethylpyrrolidin-2-one (PubChem CID 124705409) has the molecular formula C7H12BrNO and a molecular weight of 206.08 g/mol. Its IUPAC name is (5R)-5-(bromomethyl)-3,3-dimethylpyrrolidin-2-one.
| Compound Name | (5R)-5-(bromomethyl)-3,3-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 124705409 |
| Molecular Formula | C7H12BrNO |
| Molecular Weight | 206.08 g/mol |
| Exact Mass | 205.01 |
| IUPAC Name | (5R)-5-(bromomethyl)-3,3-dimethylpyrrolidin-2-one |
| SMILES | CC1(C)C[C@H](CBr)NC1=O |
| InChI | InChI=1S/C7H12BrNO/c1-7(2)3-5(4-8)9-6(7)10/h5H,3-4H2,1-2H3,(H,9,10)/t5-/m1/s1 |
| InChIKey | JPKDAZPSYHEHEN-RXMQYKEDSA-N |
| XLogP | 1.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.08 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|