C9H16BrNO — CID 125425518
(5S)-5-(bromomethyl)-3,3-diethylpyrrolidin-2-one (PubChem CID 125425518) has the molecular formula C9H16BrNO and a molecular weight of 234.14 g/mol. Its IUPAC name is (5S)-5-(bromomethyl)-3,3-diethylpyrrolidin-2-one.
| Compound Name | (5S)-5-(bromomethyl)-3,3-diethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 125425518 |
| Molecular Formula | C9H16BrNO |
| Molecular Weight | 234.14 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | (5S)-5-(bromomethyl)-3,3-diethylpyrrolidin-2-one |
| SMILES | CCC1(CC)C[C@@H](CBr)NC1=O |
| InChI | InChI=1S/C9H16BrNO/c1-3-9(4-2)5-7(6-10)11-8(9)12/h7H,3-6H2,1-2H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | FLJLHGZLHXCAKX-ZETCQYMHSA-N |
| XLogP | 2.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.14 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|