C6H9F2NO2 — CID 135231042
3,3-difluoro-5-(2-hydroxyethyl)pyrrolidin-2-one (PubChem CID 135231042) has the molecular formula C6H9F2NO2 and a molecular weight of 165.14 g/mol. Its IUPAC name is 3,3-difluoro-5-(2-hydroxyethyl)pyrrolidin-2-one.
| Compound Name | 3,3-difluoro-5-(2-hydroxyethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 135231042 |
| Molecular Formula | C6H9F2NO2 |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 3,3-difluoro-5-(2-hydroxyethyl)pyrrolidin-2-one |
| SMILES | O=C1NC(CCO)CC1(F)F |
| InChI | InChI=1S/C6H9F2NO2/c7-6(8)3-4(1-2-10)9-5(6)11/h4,10H,1-3H2,(H,9,11) |
| InChIKey | PFJOYEABKGVXOC-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |