About [(1S)-1-ethoxyethyl] N-prop-2-enylcarbamodithioate
[(1S)-1-ethoxyethyl] N-prop-2-enylcarbamodithioate (PubChem CID 124705607) has the molecular formula C8H15NOS2
and a molecular weight of 205.35 g/mol. Its IUPAC name is [(1S)-1-ethoxyethyl] N-prop-2-enylcarbamodithioate.
Molecular Properties
| Compound Name | [(1S)-1-ethoxyethyl] N-prop-2-enylcarbamodithioate |
| PubChem CID | 124705607 |
| Molecular Formula | C8H15NOS2 |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | [(1S)-1-ethoxyethyl] N-prop-2-enylcarbamodithioate |
| SMILES | C=CCNC(=S)S[C@@H](C)OCC |
| InChI | InChI=1S/C8H15NOS2/c1-4-6-9-8(11)12-7(3)10-5-2/h4,7H,1,5-6H2,2-3H3,(H,9,11)/t7-/m0/s1 |
| InChIKey | SDWQFOMIBDTVDZ-ZETCQYMHSA-N |
| XLogP | 2.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-ethoxyethyl] N-prop-2-enylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-ethoxyethyl] N-prop-2-enylcarbamodithioate?
The IUPAC name of [(1S)-1-ethoxyethyl] N-prop-2-enylcarbamodithioate (CID 124705607) is [(1S)-1-ethoxyethyl] N-prop-2-enylcarbamodithioate.
What is the SMILES notation for [(1S)-1-ethoxyethyl] N-prop-2-enylcarbamodithioate?
The canonical SMILES for [(1S)-1-ethoxyethyl] N-prop-2-enylcarbamodithioate is C=CCNC(=S)S[C@@H](C)OCC.
What is the InChIKey of [(1S)-1-ethoxyethyl] N-prop-2-enylcarbamodithioate?
The InChIKey is SDWQFOMIBDTVDZ-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H15NOS2/c1-4-6-9-8(11)12-7(3)10-5-2/h4,7H,1,5-6H2,2-3H3,(H,9,11)/t7-/m0/s1.
What are the key properties of [(1S)-1-ethoxyethyl] N-prop-2-enylcarbamodithioate?
[(1S)-1-ethoxyethyl] N-prop-2-enylcarbamodithioate has a molecular weight of 205.35 g/mol, XLogP of 2.16, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-ethoxyethyl] N-prop-2-enylcarbamodithioate is sourced from PubChem (CID 124705607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).