C14H19NO10 — CID 124718858
trimethyl (2R,3S,3aS,4S,5S)-3-(2-methoxy-2-oxoethyl)-3,3a,4,5-tetrahydro-2H-[1,2]oxazolo[2,3-b][1,2]oxazole-2,4,5-tricarboxylate (PubChem CID 124718858) has the molecular formula C14H19NO10 and a molecular weight of 361.30 g/mol. Its IUPAC name is trimethyl (2R,3S,3aS,4S,5S)-3-(2-methoxy-2-oxoethyl)-3,3a,4,5-tetrahydro-2H-[1,2]oxazolo[2,3-b][1,2]oxazole-2,4,5-tricarboxylate.
| Compound Name | trimethyl (2R,3S,3aS,4S,5S)-3-(2-methoxy-2-oxoethyl)-3,3a,4,5-tetrahydro-2H-[1,2]oxazolo[2,3-b][1,2]oxazole-2,4,5-tricarboxylate |
|---|---|
| PubChem CID | 124718858 |
| Molecular Formula | C14H19NO10 |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | trimethyl (2R,3S,3aS,4S,5S)-3-(2-methoxy-2-oxoethyl)-3,3a,4,5-tetrahydro-2H-[1,2]oxazolo[2,3-b][1,2]oxazole-2,4,5-tricarboxylate |
| SMILES | COC(=O)C[C@H]1[C@H]2[C@H](C(=O)OC)[C@@H](C(=O)OC)ON2O[C@H]1C(=O)OC |
| InChI | InChI=1S/C14H19NO10/c1-20-7(16)5-6-9-8(12(17)21-2)11(14(19)23-4)25-15(9)24-10(6)13(18)22-3/h6,8-11H,5H2,1-4H3/t6-,8-,9-,10+,11-/m0/s1 |
| InChIKey | FIJQHCWDUJPIMZ-SVIHRKJBSA-N |
| XLogP | -1.40 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|