C17H22N2O4 — CID 124721376
methyl (2S,3aR,5R,7aR)-5-methyl-4-(6-methylpyridine-3-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-2-carboxylate (PubChem CID 124721376) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is methyl (2S,3aR,5R,7aR)-5-methyl-4-(6-methylpyridine-3-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-2-carboxylate.
| Compound Name | methyl (2S,3aR,5R,7aR)-5-methyl-4-(6-methylpyridine-3-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 124721376 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | methyl (2S,3aR,5R,7aR)-5-methyl-4-(6-methylpyridine-3-carbonyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2[C@@H](CC[C@@H](C)N2C(=O)c2ccc(C)nc2)O1 |
| InChI | InChI=1S/C17H22N2O4/c1-10-4-6-12(9-18-10)16(20)19-11(2)5-7-14-13(19)8-15(23-14)17(21)22-3/h4,6,9,11,13-15H,5,7-8H2,1-3H3/t11-,13-,14-,15+/m1/s1 |
| InChIKey | ACAKZILZUQVEFK-NGFQHRJXSA-N |
| XLogP | 1.71 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |