C17H30N2O6 — CID 124724103
5-methyl-2-[(1S,2S,3R,4S)-1,2,3,4,5-pentahydroxypentyl]-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 124724103) has the molecular formula C17H30N2O6 and a molecular weight of 358.44 g/mol. Its IUPAC name is 5-methyl-2-[(1S,2S,3R,4S)-1,2,3,4,5-pentahydroxypentyl]-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one.
| Compound Name | 5-methyl-2-[(1S,2S,3R,4S)-1,2,3,4,5-pentahydroxypentyl]-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one |
|---|---|
| PubChem CID | 124724103 |
| Molecular Formula | C17H30N2O6 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 5-methyl-2-[(1S,2S,3R,4S)-1,2,3,4,5-pentahydroxypentyl]-7-propyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | CCCC12CN3CC(C)(CN(C1)C3[C@H](O)[C@H](O)[C@H](O)[C@@H](O)CO)C2=O |
| InChI | InChI=1S/C17H30N2O6/c1-3-4-17-8-18-6-16(2,15(17)25)7-19(9-17)14(18)13(24)12(23)11(22)10(21)5-20/h10-14,20-24H,3-9H2,1-2H3/t10-,11+,12+,13+,14?,16?,17?/m0/s1 |
| InChIKey | XZFAHZOLLZVOOP-WEDNZVJKSA-N |
| XLogP | -2.24 |
| TPSA | 124.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |