C16H30N2O6+2 — CID 7357825
5-ethyl-7-methyl-2-[(1S,2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 7357825) has the molecular formula C16H30N2O6+2 and a molecular weight of 346.42 g/mol. Its IUPAC name is 5-ethyl-7-methyl-2-[(1S,2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one.
| Compound Name | 5-ethyl-7-methyl-2-[(1S,2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
|---|---|
| PubChem CID | 7357825 |
| Molecular Formula | C16H30N2O6+2 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 5-ethyl-7-methyl-2-[(1S,2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | CCC12C[NH+]3CC(C)(C[NH+](C1)C3[C@H](O)[C@H](O)[C@H](O)[C@H](O)CO)C2=O |
| InChI | InChI=1S/C16H28N2O6/c1-3-16-7-17-5-15(2,14(16)24)6-18(8-16)13(17)12(23)11(22)10(21)9(20)4-19/h9-13,19-23H,3-8H2,1-2H3/p+2/t9-,10-,11-,12-,13?,15?,16?/m1/s1 |
| InChIKey | CHLXQBZFVSOSDK-ZMVJYPEASA-P |
| XLogP | -5.47 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | -5.47 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |