C19H36N2O6+2 — CID 7079433
2-[(1S,2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-5,7-di(propan-2-yl)-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 7079433) has the molecular formula C19H36N2O6+2 and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-[(1S,2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-5,7-di(propan-2-yl)-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one.
| Compound Name | 2-[(1S,2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-5,7-di(propan-2-yl)-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
|---|---|
| PubChem CID | 7079433 |
| Molecular Formula | C19H36N2O6+2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 2-[(1S,2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-5,7-di(propan-2-yl)-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | CC(C)C12C[NH+]3CC(C(C)C)(C[NH+](C1)C3[C@H](O)[C@H](O)[C@H](O)[C@H](O)CO)C2=O |
| InChI | InChI=1S/C19H34N2O6/c1-10(2)18-6-20-8-19(11(3)4,17(18)27)9-21(7-18)16(20)15(26)14(25)13(24)12(23)5-22/h10-16,22-26H,5-9H2,1-4H3/p+2/t12-,13-,14-,15-,16?,18?,19?/m1/s1 |
| InChIKey | WOPHSSJTAPPKNL-SMSOKTROSA-P |
| XLogP | -4.59 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | -4.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |