C17H32N2O6+2 — CID 7081608
5,7-diethyl-2-[(1R,2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 7081608) has the molecular formula C17H32N2O6+2 and a molecular weight of 360.45 g/mol. Its IUPAC name is 5,7-diethyl-2-[(1R,2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one.
| Compound Name | 5,7-diethyl-2-[(1R,2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
|---|---|
| PubChem CID | 7081608 |
| Molecular Formula | C17H32N2O6+2 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | 5,7-diethyl-2-[(1R,2S,3R,4R)-1,2,3,4,5-pentahydroxypentyl]-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | CCC12C[NH+]3CC(CC)(C[NH+](C1)C3[C@@H](O)[C@H](O)[C@H](O)[C@H](O)CO)C2=O |
| InChI | InChI=1S/C17H30N2O6/c1-3-16-6-18-8-17(4-2,15(16)25)9-19(7-16)14(18)13(24)12(23)11(22)10(21)5-20/h10-14,20-24H,3-9H2,1-2H3/p+2/t10-,11-,12-,13+,14?,16?,17?/m1/s1 |
| InChIKey | AQRKTEPLGLVFHX-BMZDUEENSA-P |
| XLogP | -5.08 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | -5.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |